| Nanjing Finetech Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (25) 5207-8417 +86 17714198479 | |||
![]() |
sales@fine-chemtech.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink standard supplier since 2007 | ||||
| Name | 1,1,1-Trifluoro-6-methylheptane-2,4-dione |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C8H11F3O2 |
| Molecular Weight | 196.17 |
| CAS Registry Number | 461-92-7 |
| EC Number | 207-319-6 |
| SMILES | CC(C)CC(=O)CC(=O)C(F)(F)F |
| Solubility | 1163 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.378, Calc.* |
| Melting point | -7.17 ºC |
| Boiling Point | 177.28 ºC, 183.6±35.0 ºC (760 mmHg), Calc.* |
| Flash Point | 57.3±22.8 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H225-H315-H319-H335 Details |
| Precautionary Statements | P210-P233-P240-P241-P242-P243-P261-P264-P271-P280-P303+P361+P353-P304+P340+P312-P305+P351+P338-P337+P313-P362-P370+P378-P403+P233+P235-P405-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 1,1,1-Trifluoro-6-methylheptane-2,4-dione |