| Shandong Zhengji Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 18369999171 | |||
![]() |
sales2@promisechemical.com | |||
| Chemical distributor since 2019 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | 3,4-Diethoxy Nitrobenzene |
|---|---|
| Synonyms | Benzene, 1,2-Diethoxy-4-Nitro-; 1,2-Diethoxy-4-Nitrobenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.21 |
| CAS Registry Number | 4992-63-6 |
| SMILES | CCOc1cc(ccc1OCC)[N+](=O)[O-] |
| Density | 1.2±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.520, Calc.* |
| Boiling Point | 328.6±22.0 ºC (760 mmHg), Calc.* |
| Flash Point | 145.8±24.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3,4-Diethoxy Nitrobenzene |