| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | 2-(4-Nitro-1H-imidazol-1-yl)ethanol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C5H7N3O3 |
| Molecular Weight | 157.13 |
| CAS Registry Number | 5006-69-9 |
| EC Number | 641-570-6 |
| SMILES | C1=C(N=CN1CCO)[N+](=O)[O-] |
| Solubility | 8.475e+004 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.631, Calc.* |
| Melting point | 124.56 ºC |
| Boiling Point | 345.70 ºC, 425.2±25.0 ºC (760 mmHg), Calc.* |
| Flash Point | 211.0±23.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H315-H319-H335-H341-H351-H373 Details | ||||||||||||||||||||||||
| Precautionary Statements | P201-P260-P264-P280-P501 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 2-(4-Nitro-1H-imidazol-1-yl)ethanol |