| E-fine Bio Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 15251778053 | |||
![]() |
William.efine@hotmail.com | |||
| Chemical manufacturer since 2021 | ||||
| chemBlink standard supplier since 2022 | ||||
| Name | Odevixibat |
|---|---|
| Synonyms | (2S)-2-[[(2R)-2-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1?6,2,5-benzothiadiazepin-8-yl)oxy]acetyl]amino]-2-(4-hydroxyphenyl)acetyl]amino]butanoic acid |
| Molecular Structure | ![]() |
| Protein Sequence | XX |
| Molecular Formula | C37H48N4O8S2 |
| Molecular Weight | 740.93 |
| CAS Registry Number | 501692-44-0 |
| SMILES | CCCCC1(CN(C2=CC(=C(C=C2S(=O)(=O)N1)OCC(=O)N[C@H](C3=CC=C(C=C3)O)C(=O)N[C@@H](CC)C(=O)O)SC)C4=CC=CC=C4)CCCC |
| Density | 1.3±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.643, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Odevixibat |