| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | 9-Bromo-11,17,21-trihydroxypregn-4-ene-3,20-dione 21-acetate |
|---|---|
| Synonyms | [2-[(8S,9R,10S,13S,14S,17R)-9-bromo-11,17-dihydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C23H31BrO6 |
| Molecular Weight | 483.39 |
| CAS Registry Number | 50733-54-5 |
| SMILES | CC(=O)OCC(=O)[C@]1(CC[C@@H]2[C@@]1(CC([C@]3([C@H]2CCC4=CC(=O)CC[C@@]43C)Br)O)C)O |
| Density | 1.5±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.595, Calc.* |
| Boiling Point | 611.1±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 323.4±31.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H361 Details |
| Precautionary Statements | P201-P202-P280-P308+P313 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 9-Bromo-11,17,21-trihydroxypregn-4-ene-3,20-dione 21-acetate |