| Shanghai Perno Biotechnology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 18217200601 | |||
![]() |
bush@perno.cn | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | N6-Benzoyl-5'-O-tert-butyldimethylsilyl-2'-deoxyadenosine |
|---|---|
| Synonyms | N-[9-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]purin-6-yl]benzamide |
| Molecular Structure | ![]() |
| Molecular Formula | C23H31N5O4Si |
| Molecular Weight | 469.61 |
| CAS Registry Number | 51549-39-4 |
| EC Number | 684-336-9 |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@H](C[C@@H](O1)N2C=NC3=C(N=CN=C32)NC(=O)C4=CC=CC=C4)O |
| Solubility | 0.5158 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.616, Calc.* |
| Melting point | 295.17 ºC |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H315-H319-H335 Details | ||||||||||||||||||||
| Precautionary Statements | P261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for N6-Benzoyl-5'-O-tert-butyldimethylsilyl-2'-deoxyadenosine |