| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Classification | Biochemical >> Nucleoside drugs >> Nucleotides and their analogues |
|---|---|
| Name | Isocaffeine |
| Synonyms | 1,3,9-trimethylpurine-2,6-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 |
| CAS Registry Number | 519-32-4 |
| EC Number | 208-267-7 |
| SMILES | CN1C=NC2=C1N(C(=O)N(C2=O)C)C |
| Solubility | 1686 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.679, Calc.* |
| Melting point | 180.30 ºC |
| Boiling Point | 430.85 ºC, 416.8±37.0 ºC (760 mmHg), Calc.* |
| Flash Point | 205.9±26.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302 Details | ||||||||||||
| Precautionary Statements | P264-P270-P301+P317-P330-P501 Details | ||||||||||||
| Hazard Classification | |||||||||||||
| |||||||||||||
| SDS | Available | ||||||||||||
| Market Analysis Reports |
| List of Reports Available for Isocaffeine |