| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Biochemical >> Nucleoside drugs >> Nucleotides and their analogues |
|---|---|
| Name | 1-Amino-1-deoxy-D-ribitol |
| Synonyms | (2R,3S,4S)-5-aminopentane-1,2,3,4-tetrol |
| Molecular Structure | ![]() |
| Molecular Formula | C5H13NO4 |
| Molecular Weight | 151.16 |
| CAS Registry Number | 527-47-9 |
| SMILES | C([C@@H]([C@@H]([C@@H](CO)O)O)O)N |
| Solubility | 1e+006 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.570, Calc.* |
| Melting point | 105.02 ºC |
| Boiling Point | 460.5±45.0 ºC (760 mmHg), Calc.*, 332.14 ºC |
| Flash Point | 232.3±28.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 1-Amino-1-deoxy-D-ribitol |