| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | 1-(4-Fluorophenyl)imidazolidin-2-one |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H9FN2O |
| Molecular Weight | 180.18 |
| CAS Registry Number | 53159-75-4 |
| SMILES | C1CN(C(=O)N1)C2=CC=C(C=C2)F |
| Solubility | 6477 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.557, Calc.* |
| Melting point | 106.92 ºC |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319-H335 Details |
| Precautionary Statements | P271-P261-P280 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Fluorophenyl)imidazolidin-2-one |