| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (226) 600-0236 | |||
![]() |
sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | Gibberellin A1 |
|---|---|
| Synonyms | (1R,2R,5S,8S,9S,10R,11S,12S)-5,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.39 |
| CAS Registry Number | 545-97-1 |
| EC Number | 829-308-0 |
| SMILES | C[C@@]12[C@H](CC[C@@]3([C@@H]1[C@@H]([C@]45[C@H]3CC[C@](C4)(C(=C)C5)O)C(=O)O)OC2=O)O |
| Solubility | 4263 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.639, Calc.* |
| Melting point | 217.77 ºC |
| Boiling Point | 511.07 ºC, 619.7±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 227.0±25.0 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H319 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Gibberellin A1 |