| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (226) 600-0236 | |||
![]() |
sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | 4,5-Phenanthrenedicarboxylic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H10O4 |
| Molecular Weight | 266.25 |
| CAS Registry Number | 5462-82-8 |
| SMILES | C1=CC2=C(C(=C1)C(=O)O)C3=C(C=CC=C3C(=O)O)C=C2 |
| Solubility | 0.4623 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.768, Calc.* |
| Melting point | 209.40 ºC |
| Boiling Point | 493.16 ºC, 595.1±23.0 ºC (760 mmHg), Calc.* |
| Flash Point | 327.7±19.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,5-Phenanthrenedicarboxylic acid |