| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | NK Inhibitor II, Negative Control |
|---|---|
| Synonyms | 14-methyl-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10N2O |
| Molecular Weight | 234.25 |
| CAS Registry Number | 54642-23-8 |
| SMILES | CN1C2=CC=CC3=C2C(=N1)C4=CC=CC=C4C3=O |
| Solubility | 3.15 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.737, Calc.* |
| Melting point | 168.22 ºC |
| Boiling Point | 410.91 ºC, 448.0±14.0 ºC (760 mmHg), Calc.* |
| Flash Point | 224.7±20.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319-H335 Details |
| Precautionary Statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P362-P403+P233-P405-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for NK Inhibitor II, Negative Control |