| Mascot I.E. CO.,Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (519) 8501-0339 +86 13584504415 | |||
![]() |
info@mascotchem.com | |||
![]() |
QQ chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2006 | ||||
| Name | (2R,3S,4S,5R,6S)-2-(acetoxymethyl)-6-(isopropylthio)tetrahydro-2H-pyran-3,4,5-triyl triacetate |
|---|---|
| Molecular Formula | C17H26O9S |
| Molecular Weight | 406.45 |
| CAS Registry Number | 55692-87-0 |
| SMILES | CC(C)S[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
| Solubility | 692.4 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.500, Calc.* |
| Melting point | 95.85 ºC |
| Boiling Point | 420.24 ºC, 461.2±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 215.0±16.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 Details |
| Market Analysis Reports |
| List of Reports Available for (2R,3S,4S,5R,6S)-2-(acetoxymethyl)-6-(isopropylthio)tetrahydro-2H-pyran-3,4,5-triyl triacetate |