| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (+)-Dihydroisorhamnetin |
|---|---|
| Synonyms | (2R,3R)-3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,3-dihydrochromen-4-one |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14O7 |
| Molecular Weight | 318.28 |
| CAS Registry Number | 55812-91-4 |
| SMILES | COC1=C(C=CC(=C1)[C@@H]2[C@H](C(=O)C3=C(C=C(C=C3O2)O)O)O)O |
| Density | 1.6±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.695, Calc.* |
| Boiling Point | 640.4±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 242.7±25.0 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for (+)-Dihydroisorhamnetin |