Online Database of Chemicals from Around the World
| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
 |
+1 (226) 600-0236 | |||
 |
sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | S-nitroso-N-acetylcysteine |
|---|---|
| Synonyms | (2R)-2-acetamido-3-nitrososulfanylpropanoic acid |
| Molecular Structure |  |
| Protein Sequence | X |
| Molecular Formula | C5H8N2O4S |
| Molecular Weight | 192.19 |
| CAS Registry Number | 56577-02-7 |
| SMILES | CC(=O)N[C@@H](CSN=O)C(=O)O |
| Solubility | 1.157e+004 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.598, Calc.* |
| Melting point | 151.68 ºC |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for S-nitroso-N-acetylcysteine |