| Xinxiang Runyu Material Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (373) 775-9608 | |||
![]() |
sales@runvmat.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2017 | ||||
| chemBlink standard supplier since 2019 | ||||
| Name | Bis(2-nitrobenzyl) phosphorochloridate |
|---|---|
| Synonyms | 1-[[chloro-[(2-nitrophenyl)methoxy]phosphoryl]oxymethyl]-2-nitrobenzene |
| Molecular Formula | C14H12ClN2O7P |
| Molecular Weight | 386.68 |
| CAS Registry Number | 56883-17-1 |
| SMILES | C1=CC=C(C(=C1)COP(=O)(OCC2=CC=CC=C2[N+](=O)[O-])Cl)[N+](=O)[O-] |
| Solubility | 7.777 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.612, Calc.* |
| Melting point | 90.27 ºC |
| Boiling Point | 480.00 ºC, 547.9±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 285.2±28.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Bis(2-nitrobenzyl) phosphorochloridate |