| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Dextromethorphan EP Impurity C |
|---|---|
| Synonyms | ent-3-Methoxy-17-methylmorphinan-10-one |
| Molecular Structure | ![]() |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.38 |
| CAS Registry Number | 57969-05-8 |
| EC Number | 641-611-8 |
| SMILES | CN1CC[C@@]23CCCC[C@@H]2[C@@H]1C(=O)C4=C3C=C(C=C4)OC |
| Solubility | 33.26 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.596, Calc.* |
| Melting point | 141.84 ºC |
| Boiling Point | 380.53 ºC, 446.2±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 223.7±28.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302 Details | ||||||||||||
| Precautionary Statements | P264-P270-P301+P317-P330-P501 Details | ||||||||||||
| Hazard Classification | |||||||||||||
| |||||||||||||
| SDS | Available | ||||||||||||
| Market Analysis Reports |
| List of Reports Available for Dextromethorphan EP Impurity C |