| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (226) 600-0236 | |||
![]() |
sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | 5-(acetyloxy)-4-phenyl-1-Benzothiepin-3-carbonitrile |
|---|---|
| Synonyms | (3-cyano-4-phenyl-1-benzothiepin-5-yl) acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C19H13NO2S |
| Molecular Weight | 319.38 |
| CAS Registry Number | 5866-53-5 |
| EC Number | 828-931-5 |
| SMILES | CC(=O)OC1=C(C(=CSC2=CC=CC=C21)C#N)C3=CC=CC=C3 |
| Density | 1.2±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.570, Calc.* |
| Boiling Point | 472.1±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 239.3±28.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H315-H319-H335 Details | ||||||||||||||||||||
| Precautionary Statements | P261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 5-(acetyloxy)-4-phenyl-1-Benzothiepin-3-carbonitrile |