| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-[(2-amino-6-oxo-3H-purin-9-yl)methoxy]ethyl Benzoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H15N5O4 |
| Molecular Weight | 329.31 |
| CAS Registry Number | 59277-91-7 |
| EC Number | 641-643-2 |
| SMILES | C1=CC=C(C=C1)C(=O)OCCOCN2C=NC3=C2N=C(NC3=O)N |
| Solubility | 2.894e+005 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.693, Calc.* |
| Melting point | 249.11 ºC |
| Boiling Point | 578.17 ºC, 585.8±58.0 ºC (760 mmHg), Calc.* |
| Flash Point | 308.1±32.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 2-[(2-amino-6-oxo-3H-purin-9-yl)methoxy]ethyl Benzoate |