| Territorial Sea Technology Qingdao Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 15092083467 | |||
![]() |
13675327813@163.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2021 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | Pentafluorophenyl trifluoromethanesulfonate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C7F8O3S |
| Molecular Weight | 316.13 |
| CAS Registry Number | 60129-85-3 |
| EC Number | 808-204-9 |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)OS(=O)(=O)C(F)(F)F |
| Solubility | 2.337 mg/L (25 ºC water) |
|---|---|
| Density | 1.8±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.413, Calc.* |
| Melting point | 66.22 ºC |
| Boiling Point | 252.32 ºC, 223.4±40.0 ºC (760 mmHg), Calc.* |
| Flash Point | 88.9±27.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H315-H319-H335 Details | ||||||||||||||||||||
| Precautionary Statements | P261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for Pentafluorophenyl trifluoromethanesulfonate |