| Jiangxi Xingao Medical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (0576) 8980-6670 | |||
![]() |
william@xingaopharma.com | |||
![]() |
WeChat: 008613867636668 | |||
| Chemical manufacturer since 2021 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | Heptafluoropropyl pentafluoroethyl ether |
|---|---|
| Synonyms | 1,1,1,2,2,3,3-heptafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propane |
| Molecular Structure | ![]() |
| Molecular Formula | C5F12O |
| Molecular Weight | 304.03 |
| CAS Registry Number | 60164-51-4 |
| EC Number | 611-940-1 |
| SMILES | C(C(OC(C(F)(F)F)(F)F)(F)F)(C(F)(F)F)(F)F |
| Solubility | 0.7652 mg/L (25 ºC water) |
|---|---|
| Density | 1.7±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.249, Calc.* |
| Melting point | -90.62 ºC |
| Boiling Point | 30.95 ºC, 38.3±40.0 ºC (760 mmHg), Calc.* |
| Flash Point | -18.3±23.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H319--H335 Details | ||||||||||||||||
| Precautionary Statements | P261-P264+P265-P271-P280-P304+P340-P305+P351+P338-P319-P337+P317-P403+P233-P405-P501 Details | ||||||||||||||||
| Hazard Classification | |||||||||||||||||
| |||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for Heptafluoropropyl pentafluoroethyl ether |