|
CAS: 61406-66-4 Product: rac-(3S)-1-(tert-butoxycarbonyl)-3-methyl-L-proline No suppilers available. |
| Name | rac-(3S)-1-(tert-butoxycarbonyl)-3-methyl-L-proline |
|---|---|
| Synonyms | (2S,3S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.27 |
| CAS Registry Number | 61406-66-4 |
| SMILES | C[C@H]1CCN([C@@H]1C(=O)O)C(=O)OC(C)(C)C |
| Density | 1.2±0.0 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.490, Calc.* |
| Boiling Point | 343.2±0.0 ºC (760 mmHg), Calc.* |
| Flash Point | 161.4±0.0 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302 Details |
| Precautionary Statements | P264-P270-P301+P312-P330-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for rac-(3S)-1-(tert-butoxycarbonyl)-3-methyl-L-proline |