| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Prednisolone-21-Carboxylic Acid |
|---|---|
| Synonyms | 3-[(8R,9S,10R,13S,14R,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-hydroxy-3-oxopropanoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C22H28O7 |
| Molecular Weight | 404.45 |
| CAS Registry Number | 61549-70-0 |
| SMILES | C[C@]12CC([C@H]3[C@@H]([C@H]1CC[C@@]2(C(=O)C(C(=O)O)O)O)CCC4=CC(=O)C=C[C@]34C)O |
| Density | 1.4±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.631, Calc.* |
| Boiling Point | 653.9±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 363.2±28.0 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Prednisolone-21-Carboxylic Acid |