| Allfluoro pharmaceutical co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 2613-7118 | |||
![]() |
sales@allfluoro.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink standard supplier since 2020 | ||||
| Name | 2-Chloro-6-(trifluoromethyl)pyrazine |
|---|---|
| Molecular Formula | C5H2ClF3N2 |
| Molecular Weight | 182.53 |
| CAS Registry Number | 61655-69-4 |
| EC Number | 874-755-7 |
| SMILES | C1=C(N=C(C=N1)Cl)C(F)(F)F |
| Solubility | 2551 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.445, Calc.* |
| Melting point | 10.00 ºC |
| Boiling Point | 166.63 ºC, 141.2±35.0 ºC (760 mmHg), Calc.* |
| Flash Point | 39.2±25.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H315-H319-H335 Details | ||||||||||||||||||||||||
| Precautionary Statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-6-(trifluoromethyl)pyrazine |