| Henan Ouber Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (371) 6532-2607 +86 18937141980 | |||
![]() |
anna.zhang@oubertec.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18937141980 | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink massive supplier since 2020 | ||||
| Name | 4,4-Difluoro-1-phenylbutane-1,3-dione |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H8F2O2 |
| Molecular Weight | 198.17 |
| CAS Registry Number | 62679-61-2 |
| EC Number | 670-672-3 |
| SMILES | C1=CC=C(C=C1)C(=O)CC(=O)C(F)F |
| Solubility | 1.981e+004 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.477, Calc.* |
| Melting point | 38.89 ºC |
| Boiling Point | 272.9±30.0 ºC (760 mmHg), Calc.*, 256.36 ºC |
| Flash Point | 104.3±18.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H315-H319-H335 Details | ||||||||||||||||||||||||
| Precautionary Statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 4,4-Difluoro-1-phenylbutane-1,3-dione |