| Chengdu Push Bio-technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (028) 8537-0506-229 | |||
![]() |
3004654993@qq.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18080489829 | |||
| Chemical manufacturer since 2005 | ||||
| chemBlink standard supplier since 2023 | ||||
| Classification | Biochemical >> Natural biochemical product |
|---|---|
| Name | Kuwanon B |
| Synonyms | 5,7-dihydroxy-2-(5-hydroxy-2,2-dimethylchromen-6-yl)-3-(3-methylbut-2-enyl)chromen-4-one |
| Molecular Structure | ![]() |
| Molecular Formula | C25H24O6 |
| Molecular Weight | 420.45 |
| CAS Registry Number | 62949-78-4 |
| SMILES | CC(=CCC1=C(OC2=CC(=CC(=C2C1=O)O)O)C3=C(C4=C(C=C3)OC(C=C4)(C)C)O)C |
| Density | 1.3±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.636, Calc.* |
| Boiling Point | 619.5±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 212.6±25.0 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software |
| Market Analysis Reports |
| List of Reports Available for Kuwanon B |