| Pribolab Pte. Ltd. | Singapore | Inquire | ||
|---|---|---|---|---|
![]() |
+86 4006885349 | |||
![]() |
sales@pribolab.com | |||
| Chemical manufacturer since 2008 | ||||
| chemBlink standard supplier since 2021 | ||||
| Name | 8-Acetylneosolaniol |
|---|---|
| Synonyms | [(1S,2R,4S,7R,9R,10R,11S,12S)-4,11-diacetyloxy-10-hydroxy-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-2-yl]methyl acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C21H28O9 |
| Molecular Weight | 424.44 |
| CAS Registry Number | 65041-92-1 |
| EC Number | 695-083-9 |
| SMILES | CC1=C[C@@H]2[C@](C[C@@H]1OC(=O)C)([C@]3([C@@H]([C@H]([C@H]([C@@]34CO4)O2)O)OC(=O)C)C)COC(=O)C |
| Solubility | 1271 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.558, Calc.* |
| Melting point | 181.32 ºC |
| Boiling Point | 455.68 ºC, 516.8±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 174.1±23.6 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H301-H315 Details | ||||||||||||||||
| Precautionary Statements | P264-P270-P280-P301+P316-P302+P352-P321-P330-P332+P317-P362+P364-P405-P501 Details | ||||||||||||||||
| Hazard Classification | |||||||||||||||||
| |||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 8-Acetylneosolaniol |