| Hoffman Fine Chemicals Pty Ltd | Australia | Inquire | ||
|---|---|---|---|---|
![]() |
+61 3-7003-5401 | |||
![]() |
info@hoffmanchemicals.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | 3,5-Dimethoxy-4-iodobenzoic acid methyl ester |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H11IO4 |
| Molecular Weight | 322.10 |
| CAS Registry Number | 65566-16-7 |
| SMILES | COC1=CC(=CC(=C1I)OC)C(=O)OC |
| Density | 1.6±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.565, Calc.* |
| Boiling Point | 373.3±42.0 ºC (760 mmHg), Calc.* |
| Flash Point | 179.6±27.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dimethoxy-4-iodobenzoic acid methyl ester |