Online Database of Chemicals from Around the World
| Nanjing Finetech Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (25) 5207-8417 +86 17714198479 | |||
 |
sales@fine-chemtech.com | |||
 |
QQ chat | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink standard supplier since 2007 | ||||
| Name | 3-Isobutyl-5-(trifluoromethyl)-1H-pyrazole |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C8H11F3N2 |
| Molecular Weight | 192.18 |
| CAS Registry Number | 67294-34-2 |
| SMILES | CC(C)CC1=CC(=NN1)C(F)(F)F |
| Solubility | 139.7 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.442, Calc.* |
| Melting point | 47.40 ºC |
| Boiling Point | 246.97 ºC, 228.2±35.0 ºC (760 mmHg), Calc.* |
| Flash Point | 91.8±25.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 3-Isobutyl-5-(trifluoromethyl)-1H-pyrazole |