| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | (E)-Ceftizoxime |
|---|---|
| Synonyms | (6R,7R)-7-((E)-2-(2-Aminothiazol-4-yl)-2-(methoxyimino)acetamido)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13N5O5S2 |
| Molecular Weight | 383.40 |
| CAS Registry Number | 68403-31-6 |
| SMILES | CO/N=C(\c1csc(n1)N)/C(=O)N[C@H]2[C@@H]3N(C2=O)C(=CCS3)C(=O)O |
| Solubility | 1321 mg/L (25 ºC water) |
|---|---|
| Density | 1.9±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.849, Calc.* |
| Melting point | 286.94 ºC |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Precautionary Statements | P264-P301+P312 Details |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (E)-Ceftizoxime |