|
CAS: 69673-92-3 Product: 2-Chloro-1-(4-methylphenyl)-1-Propanone No suppilers available. |
| Name | 2-Chloro-1-(4-methylphenyl)-1-Propanone |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H11ClO |
| Molecular Weight | 182.65 |
| CAS Registry Number | 69673-92-3 |
| SMILES | CC1=CC=C(C=C1)C(=O)C(C)Cl |
| Solubility | 181 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.523, Calc.* |
| Melting point | 34.47 ºC |
| Boiling Point | 256.07 ºC, 267.8±15.0 ºC (760 mmHg), Calc.* |
| Flash Point | 138.4±11.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319-H335 Details |
| Precautionary Statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P332+P313-P337+P313-P362-P403+P233-P405-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-1-(4-methylphenyl)-1-Propanone |