| Guangzhou Lanning Biotechnology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 15813355568 | |||
![]() |
lanningsale@sina.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 15813355568 | |||
![]() |
WhatsApp: +8615813355568 | |||
| Chemical manufacturer since 2022 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | Mupirocin EP Impurity B |
|---|---|
| Synonyms | Pseudomonic acid C;9-[(E)-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-[(E,4R,5S)-5-hydroxy-4-methylhex-2-enyl]oxan-2-yl]-3-methylbut-2-enoyl]oxynonanoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C26H44O8 |
| Molecular Weight | 484.62 |
| CAS Registry Number | 71980-98-8 |
| SMILES | C[C@H](/C=C/C[C@H]1CO[C@H]([C@@H]([C@@H]1O)O)C/C(=C/C(=O)OCCCCCCCCC(=O)O)/C)[C@H](C)O |
| Solubility | 0.5133 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.516, Calc.* |
| Melting point | 268.63 ºC |
| Boiling Point | 619.96 ºC, 656.2±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 210.3±25.0 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302+H312+H332-H315-H319 Details |
| Precautionary Statements | P261-P271-P280-P302+P352-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Mupirocin EP Impurity B |