| Z Intellecchem & Tech. Co., Ltd | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 15050866711 | |||
![]() |
contact@zintellec.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink standard supplier since 2021 | ||||
| Name | 3',4'-Dichlorocapryloanilide |
|---|---|
| Synonyms | N-(3,4-dichlorophenyl)octanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C14H19Cl2NO |
| Molecular Weight | 288.21 |
| CAS Registry Number | 730-25-6 |
| EC Number | 871-731-8 |
| SMILES | CCCCCCCC(=O)NC1=CC(=C(C=C1)Cl)Cl |
| Solubility | 0.3992 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.549, Calc.* |
| Melting point | 161.85 ºC |
| Boiling Point | 412.95 ºC, 425.9±35.0 ºC (760 mmHg), Calc.* |
| Flash Point | 211.4±25.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302 Details | ||||||||||||
| Precautionary Statements | P264-P270-P301+P312-P330-P501 Details | ||||||||||||
| Hazard Classification | |||||||||||||
| |||||||||||||
| SDS | Available | ||||||||||||
| Market Analysis Reports |
| List of Reports Available for 3',4'-Dichlorocapryloanilide |