| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (226) 600-0236 | |||
![]() |
sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | Sinapic acid |
|---|---|
| Synonyms | (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 |
| CAS Registry Number | 7362-37-0 |
| EC Number | 208-487-3 |
| SMILES | COC1=CC(=CC(=C1O)OC)/C=C/C(=O)O |
| Solubility | 7082 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.604, Calc.* |
| Melting point | 146.32 ºC |
| Boiling Point | 377.86 ºC, 403.4±40.0 ºC (760 mmHg), Calc.* |
| Flash Point | 158.6±20.8 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319-H335 Details |
| Precautionary Statements | P261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Sinapic acid |