| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Biochemical >> Natural biochemical product |
|---|---|
| Name | Haginin A |
| Synonyms | 3-(4-hydroxy-2,3-dimethoxyphenyl)-2H-chromen-7-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 |
| CAS Registry Number | 74174-29-1 |
| SMILES | COC1=C(C=CC(=C1OC)O)C2=CC3=C(C=C(C=C3)O)OC2 |
| Solubility | 133.2 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.632, Calc.* |
| Melting point | 186.49 ºC |
| Boiling Point | 520.9±50.0 ºC (760 mmHg), Calc.*, 444.10 ºC |
| Flash Point | 268.8±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Haginin A |