| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (226) 600-0236 | |||
![]() |
sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | (R)-3-Amino-3-(3-cyanophenyl)propanoic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 |
| CAS Registry Number | 761396-82-1 |
| SMILES | C1=CC(=CC(=C1)[C@@H](CC(=O)O)N)C#N |
| Solubility | 6.954e+004 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.596, Calc.* |
| Melting point | 298.10 ºC |
| Boiling Point | 439.36 ºC, 371.3±37.0 ºC (760 mmHg), Calc.* |
| Flash Point | 178.3±26.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (R)-3-Amino-3-(3-cyanophenyl)propanoic acid |