| Hoffman Fine Chemicals Pty Ltd | Australia | Inquire | ||
|---|---|---|---|---|
![]() |
+61 3-7003-5401 | |||
![]() |
info@hoffmanchemicals.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | Pyridin-3-yl(pyrrolidin-1-yl)methanone |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 |
| CAS Registry Number | 77727-88-9 |
| SMILES | C1CCN(C1)C(=O)C2=CN=CC=C2 |
| Solubility | 2.566e+004 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.578, Calc.* |
| Melting point | 89.88 ºC |
| Boiling Point | 308.40 ºC, 328.8±15.0 ºC (760 mmHg), Calc.* |
| Flash Point | 152.6±20.4 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Pyridin-3-yl(pyrrolidin-1-yl)methanone |