| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Adrenaline EP Impurity F |
|---|---|
| Synonyms | (1R)-1-(3,4-dihydroxyphenyl)-2-(methylamino)ethanesulfonic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13NO5S |
| Molecular Weight | 247.27 |
| CAS Registry Number | 78995-75-2 |
| EC Number | 642-207-4 |
| SMILES | CNC[C@@H](C1=CC(=C(C=C1)O)O)S(=O)(=O)O |
| Density | 1.5±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.622, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Adrenaline EP Impurity F |