| Reliable Life Science | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 982 588 6288 | |||
![]() |
info@gyangroup.in | |||
| Chemical manufacturer since 2017 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | N-[4-[[(4-chloro-3-nitrophenyl)sulphonyl]amino]phenyl]acetamide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H12ClN3O5S |
| Molecular Weight | 369.78 |
| CAS Registry Number | 79817-49-5 |
| EC Number | 279-279-8 |
| SMILES | CC(=O)NC1=CC=C(C=C1)NS(=O)(=O)C2=CC(=C(C=C2)Cl)[N+](=O)[O-] |
| Solubility | 25.25 mg/L (25 ºC water) |
|---|---|
| Density | 1.6±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.669, Calc.* |
| Melting point | 244.53 ºC |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for N-[4-[[(4-chloro-3-nitrophenyl)sulphonyl]amino]phenyl]acetamide |