| Agrige Bioscience Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 17321027985 | |||
![]() |
sales@agrige.com | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink standard supplier since 2022 | ||||
| Name | Methyl 2-chloro-6-nitrobenzoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C8H6ClNO4 |
| Molecular Weight | 215.59 |
| CAS Registry Number | 80563-87-7 |
| SMILES | COC(=O)C1=C(C=CC=C1Cl)[N+](=O)[O-] |
| Solubility | 191.8 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.568, Calc.* |
| Melting point | 92.35 ºC |
| Boiling Point | 306.16 ºC, 291.6±20.0 ºC (760 mmHg), Calc.* |
| Flash Point | 130.2±21.8 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methyl 2-chloro-6-nitrobenzoate |