| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,2',2''-(Benzene-1,3,5-triyl)triacetonitrile |
|---|---|
| Synonyms | 2-[3,5-bis(cyanomethyl)phenyl]acetonitrile |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9N3 |
| Molecular Weight | 195.22 |
| CAS Registry Number | 80935-59-7 |
| SMILES | C1=C(C=C(C=C1CC#N)CC#N)CC#N |
| Solubility | 6335 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.564, Calc.* |
| Melting point | 137.65 ºC |
| Boiling Point | 395.79 ºC, 429.0±40.0 ºC (760 mmHg), Calc.* |
| Flash Point | 216.3±21.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H301+H311+H331-H315-H319 Details |
| Precautionary Statements | P501-P261-P270-P271-P264-P280-P337+P313-P305+P351+P338-P361+P364-P332+P313-P301+P310+P330-P302+P352+P312-P304+P340+P311-P403+P233-P405 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2,2',2''-(Benzene-1,3,5-triyl)triacetonitrile |