| Wuhan Boyuan Import & Export Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 15733174274 | |||
![]() |
wu596821126@gmail.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 15733174274 | |||
![]() |
WhatsApp: +86 15733174274 | |||
| Chemical manufacturer since 2018 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | 5-Methoxy-3-methyl-benzofuran-2-carboxylic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.19 |
| CAS Registry Number | 81718-77-6 |
| EC Number | 836-716-2 |
| SMILES | CC1=C(OC2=C1C=C(C=C2)OC)C(=O)O |
| Solubility | 165 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.605, Calc.* |
| Melting point | 132.54 ºC |
| Boiling Point | 354.93 ºC, 367.1±37.0 ºC (760 mmHg), Calc.* |
| Flash Point | 175.8±26.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H315-H319-H335 Details | ||||||||||||||||||||
| Precautionary Statements | P261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 5-Methoxy-3-methyl-benzofuran-2-carboxylic acid |