Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Etomidate Impurity 1 |
|---|---|
| Synonyms | 1-[(1R)-1-Phenylethyl]-1H-imidazole |
| Molecular Structure | ![CAS # 844658-92-0, Etomidate Impurity 1, 1-[(1R)-1-Phenylethyl]-1H-imidazole](/structures/844658-92-0.gif) |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 |
| CAS Registry Number | 844658-92-0 |
| SMILES | C[C@H](C1=CC=CC=C1)N2C=CN=C2 |
| Solubility | 279.1 mg/L (25 ºC water) |
|---|---|
| Density | 1.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.571, Calc.* |
| Melting point | 85.09 ºC |
| Boiling Point | 322.16 ºC, 307.6±11.0 ºC (760 mmHg), Calc.* |
| Flash Point | 139.9±19.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Etomidate Impurity 1 |