| Hoffman Fine Chemicals Pty Ltd | Australia | Inquire | ||
|---|---|---|---|---|
![]() |
+61 3-7003-5401 | |||
![]() |
info@hoffmanchemicals.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | 2-Chloro-3-fluorophenyl diethylcarbamate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H13ClFNO2 |
| Molecular Weight | 245.68 |
| CAS Registry Number | 863870-76-2 |
| SMILES | CCN(CC)C(=O)OC1=C(C(=CC=C1)F)Cl |
| Solubility | 50.97 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.513, Calc.* |
| Melting point | 69.77 ºC |
| Boiling Point | 290.54 ºC, 307.1±42.0 ºC (760 mmHg), Calc.* |
| Flash Point | 139.5±27.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-3-fluorophenyl diethylcarbamate |