| Hoffman Fine Chemicals Pty Ltd | Australia | Inquire | ||
|---|---|---|---|---|
![]() |
+61 3-7003-5401 | |||
![]() |
info@hoffmanchemicals.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | 3-Bromo-2-iodophenyl diethylcarbamate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H13BrINO2 |
| Molecular Weight | 398.03 |
| CAS Registry Number | 863870-79-5 |
| SMILES | CCN(CC)C(=O)OC1=C(C(=CC=C1)Br)I |
| Solubility | 0.5921 mg/L (25 ºC water) |
|---|---|
| Density | 1.8±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.598, Calc.* |
| Melting point | 119.28 ºC |
| Boiling Point | 361.61 ºC, 384.2±42.0 ºC (760 mmHg), Calc.* |
| Flash Point | 186.1±27.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 3-Bromo-2-iodophenyl diethylcarbamate |