|
CAS: 871353-25-2 Product: 3-Bromo-2-fluorobenzamide No suppilers available. |
| Name | 3-Bromo-2-fluorobenzamide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C7H5BrFNO |
| Molecular Weight | 218.02 |
| CAS Registry Number | 871353-25-2 |
| SMILES | C1=CC(=C(C(=C1)Br)F)C(=O)N |
| Density | 1.7±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.582, Calc.* |
| Boiling Point | 250.6±30.0 ºC (760 mmHg), Calc.* |
| Flash Point | 105.4±24.6 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H301-H311-H331 Details |
| Precautionary Statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P310-P330-P361-P403+P233-P405-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 3-Bromo-2-fluorobenzamide |