| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N-(2-(((2,3-Difluorophenyl)methyl)thio)-6-(((1R,2S)-2,3-dihydroxy-1-methylpropyl)oxy)-4-pyrimidinyl)-1-azetidinesulfonamide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C18H22F2N4O5S2 |
| Molecular Weight | 476.52 |
| CAS Registry Number | 878385-84-3 |
| EC Number | 688-153-5 |
| SMILES | C[C@H]([C@H](CO)O)OC1=NC(=NC(=C1)NS(=O)(=O)N2CCC2)SCC3=C(C(=CC=C3)F)F |
| nsity | 1.6±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.651, Calc.* |
| Boiling Point | 680.5±65.0 ºC (760 mmHg), Calc.* |
| Flash Point | 365.4±34.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H360 Details | ||||||||||||
| Precautionary Statements | P201-P202-P280-P308+P313-P405-P501 Details | ||||||||||||
| Hazard Classification | |||||||||||||
| |||||||||||||
| SDS | Available | ||||||||||||
| Market Analysis Reports |
| List of Reports Available for N-(2-(((2,3-Difluorophenyl)methyl)thio)-6-(((1R,2S)-2,3-dihydroxy-1-methylpropyl)oxy)-4-pyrimidinyl)-1-azetidinesulfonamide |