| All Chemistry Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (609) 531-0668 | |||
![]() |
info@all-chemistry.com | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink standard supplier since 2022 | ||||
| Name | 2-[(3-Chloro-4-fluorophenyl)hydrazono]-3-(4-chlorophenyl)-3-oxo-propionitrile |
|---|---|
| Synonyms | (1E)-N-(3-chloro-4-fluoroanilino)-2-(4-chlorophenyl)-2-oxoethanimidoyl cyanide |
| Molecular Structure | ![]() |
| Molecular Formula | C15H8Cl2FN3O |
| Molecular Weight | 336.15 |
| CAS Registry Number | 882290-02-0 |
| SMILES | C1=CC(=CC=C1C(=O)/C(=N/NC2=CC(=C(C=C2)F)Cl)/C#N)Cl |
| Solubility | 0.01319 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.615, Calc.* |
| Melting point | 174.32 ºC |
| Boiling Point | 444.72 ºC, 459.4±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 231.6±31.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H312-H332 Details |
| Precautionary Statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P330-P362-P403+P233-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2-[(3-Chloro-4-fluorophenyl)hydrazono]-3-(4-chlorophenyl)-3-oxo-propionitrile |