| LinkChem Shanghai Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 5895-0110 +86 13391192982 | |||
![]() |
sales@linkchem.cn | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2011 | ||||
| Name | Dimethyl (S)-(3-methyl-2-oxohept-5-yn-1-yl)phosphonate |
|---|---|
| Synonyms | (3S)-1-dimethoxyphosphoryl-3-methylhept-5-yn-2-one |
| Molecular Structure | ![]() |
| Molecular Formula | C10H17O4P |
| Molecular Weight | 232.21 |
| CAS Registry Number | 88295-05-0 |
| SMILES | CC#CCC(C)C(=O)CP(=O)(OC)OC |
| Solubility | 5976 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.450, Calc.* |
| Melting point | 72.39 ºC |
| Boiling Point | 314.16 ºC, 328.0±27.0 ºC (760 mmHg), Calc.* |
| Flash Point | 165.9±44.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Dimethyl (S)-(3-methyl-2-oxohept-5-yn-1-yl)phosphonate |