| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Ethyl [(5-chloroquinolin-8-yl)oxy]acetate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C13H12ClNO3 |
| Molecular Weight | 265.69 |
| CAS Registry Number | 88349-90-0 |
| SMILES | CCOC(=O)COC1=C2C(=C(C=C1)Cl)C=CC=N2 |
| Solubility | 64.53 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.590, Calc.* |
| Melting point | 128.43 ºC |
| Boiling Point | 366.17 ºC, 393.4±27.0 ºC (760 mmHg), Calc.* |
| Flash Point | 191.7±23.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319 Details |
| Precautionary Statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313-P362 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Ethyl [(5-chloroquinolin-8-yl)oxy]acetate |